cas: 115499-45-1 — see every product listed under this CAS number, including other names
[2-(4-Hydroxy-phenoxy)-ethyl]-carbamic acid tert-butyl ester, ≥95%, ≥95% (CAS 115499-45-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12NYCC-50mg |
| cas | 115499-45-1 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 3626.00 Pln | |
| Chemat | 100mg | 4514.00 Pln | |
| Chemat | 250mg | 5301.20 Pln | |
| Chemat | 1g | 6885.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[2-(4-hydroxyphenoxy)ethyl]carbamate (CAS 115499-45-1) is a chemical compound with the molecular formula C13H19NO4 and a molecular weight of 253.29 g/mol. IUPAC name: tert-butyl N-[2-(4-hydroxyphenoxy)ethyl]carbamate. InChIKey: WESMLFSTFVCSOA-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | tert-butyl N-[2-(4-hydroxyphenoxy)ethyl]carbamate |
| InChIKey | WESMLFSTFVCSOA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)