Products 460750-27-0

CAS 460750-27-0 is the registry number for Ethyl 2-amino-4,5-diethoxybenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-4,5-diethoxybenzoate (CAS 460750-27-0) is a chemical compound with the molecular formula C13H19NO4 and a molecular weight of 253.29 g/mol. IUPAC name: ethyl 2-amino-4,5-diethoxybenzoate. InChIKey: VALSMHHGXJRDCC-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO4
Molecular weight253.29 g/mol
IUPAC nameethyl 2-amino-4,5-diethoxybenzoate
InChIKeyVALSMHHGXJRDCC-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C(=C1)C(=O)OCC)N)OCC

Computed by PubChem (NCBI)