cas: 397843-66-2 — see every product listed under this CAS number, including other names
[4-[(DIBUTYLAMINO)CARBONYL]PHENYL]BORONIC ACID, 97%, 97% (CAS 397843-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FU88-100mg |
| cas | 397843-66-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 746.00 Pln | |
| Chemat | 1g | 2128.40 Pln | |
| Chemat | 5g | 4874.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[4-(dibutylcarbamoyl)phenyl]boronic acid (CAS 397843-66-2) is a chemical compound with the molecular formula C15H24BNO3 and a molecular weight of 277.17 g/mol. IUPAC name: [4-(dibutylcarbamoyl)phenyl]boronic acid. InChIKey: IPOSLHSSMGIXCM-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO3 |
|---|---|
| Molecular weight | 277.17 g/mol |
| IUPAC name | [4-(dibutylcarbamoyl)phenyl]boronic acid |
| InChIKey | IPOSLHSSMGIXCM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)N(CCCC)CCCC)(O)O |
Computed by PubChem (NCBI)