CAS 2750602-21-0 is the registry number for 2-Isopropyl-4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxy-2-propan-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2750602-21-0) is a chemical compound with the molecular formula C15H24BNO3 and a molecular weight of 277.17 g/mol. IUPAC name: 4-methoxy-2-propan-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: OMNQYYPXADISGW-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO3 |
|---|---|
| Molecular weight | 277.17 g/mol |
| IUPAC name | 4-methoxy-2-propan-2-yl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | OMNQYYPXADISGW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2C(C)C)OC |
Computed by PubChem (NCBI)