cas: 879896-50-1 — see every product listed under this CAS number, including other names
{2-[(4-Methylpiperazin-1-yl)methyl]phenyl}methylamine, 97% (CAS 879896-50-1) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC47413CB |
| cas | 879896-50-1 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 268.79 Pln | |
| Thermo Scientific | 1g | 789.07 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanamine (CAS 879896-50-1) is a chemical compound with the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. IUPAC name: [2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanamine. InChIKey: OKGWICVOLZFMPE-UHFFFAOYSA-N.
| Molecular formula | C13H21N3 |
|---|---|
| Molecular weight | 219.33 g/mol |
| IUPAC name | [2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanamine |
| InChIKey | OKGWICVOLZFMPE-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=CC=C2CN |
Computed by PubChem (NCBI)