cas: 879896-50-1 — see every product listed under this CAS number, including other names
2-(4-Methylpiperazin-1-ylmethyl)benzylamine, 97% (CAS 879896-50-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A163449-250mg |
| cas | 879896-50-1 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 851.20 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 700.81 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanamine (CAS 879896-50-1) is a chemical compound with the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. IUPAC name: [2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanamine. InChIKey: OKGWICVOLZFMPE-UHFFFAOYSA-N.
| Molecular formula | C13H21N3 |
|---|---|
| Molecular weight | 219.33 g/mol |
| IUPAC name | [2-[(4-methylpiperazin-1-yl)methyl]phenyl]methanamine |
| InChIKey | OKGWICVOLZFMPE-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=CC=C2CN |
Computed by PubChem (NCBI)