β-catenin-IN-2
cas: 1458664-10-2 — see every product listed under this CAS number, including other names
β-catenin-IN-2 (CAS 1458664-10-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Offered by: TargetMol, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T9696-1mg |
| cas | 1458664-10-2 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 810.99 Pln | |
| TargetMol | 5mg | 1707.62 Pln | |
| TargetMol | 10mg | 2584.14 Pln | |
| TargetMol | 25mg | 4230.95 Pln | |
| TargetMol | 50mg | 5957.70 Pln | |
| TargetMol | 100mg | 7956.68 Pln | |
| TargetMol | 500mg | 15905.66 Pln | |
| Chemat | 50mg | 3544.40 Pln | |
| Chemat | 100mg | 4725.20 Pln | |
| Chemat | 1mg | 462.80 Pln | |
| Chemat | 5mg | 1038.80 Pln | |
| Chemat | 10mg | 1629.20 Pln | |
| Chemat | 25mg | 2579.60 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
4-(6-fluoro-1H-benzimidazol-2-yl)-N,N-dimethylaniline (CAS 1458664-10-2) is a chemical compound with the molecular formula C15H14FN3 and a molecular weight of 255.29 g/mol. IUPAC name: 4-(6-fluoro-1H-benzimidazol-2-yl)-N,N-dimethylaniline. InChIKey: ALWZHAOGGMSYPG-UHFFFAOYSA-N.
| Molecular formula | C15H14FN3 |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 4-(6-fluoro-1H-benzimidazol-2-yl)-N,N-dimethylaniline |
| InChIKey | ALWZHAOGGMSYPG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=C(N2)C=C(C=C3)F |
Computed by PubChem (NCBI)
Synonyms:
beta-catenin-IN-2, 4-(6-Fluoro-1H-benzo[d]imidazol-2-yl)-N,N-dimethylaniline, 4-(6-fluoro-1H-benzimidazol-2-yl)-N,N-dimethylaniline, 4-(5-Fluoro-1H-1,3-benzodiazol-2-yl)-N,N-dimethylaniline, yena-catenin-IN-2, beta-catenin-IN-2?, ??-catenin-IN-2, orb1297941, 4-(5-Fluoro-1H-benzo[d]imidazol-2-yl)-N,N-dimethylaniline