CAS 1458664-10-2 appears in our catalog under these names: β–catenin–IN–2, β-catenin-IN-2, β-catenin-IN-2, 99.55%, 4-(5-Fluoro-1H-1,3-benzodiazol-2-yl)-N,N-dimethylaniline. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, TRC. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 5mg, 50mg, 1mg, 25mg, 500mg.
4-(6-fluoro-1H-benzimidazol-2-yl)-N,N-dimethylaniline (CAS 1458664-10-2) is a chemical compound with the molecular formula C15H14FN3 and a molecular weight of 255.29 g/mol. IUPAC name: 4-(6-fluoro-1H-benzimidazol-2-yl)-N,N-dimethylaniline. InChIKey: ALWZHAOGGMSYPG-UHFFFAOYSA-N.
| Molecular formula | C15H14FN3 |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 4-(6-fluoro-1H-benzimidazol-2-yl)-N,N-dimethylaniline |
| InChIKey | ALWZHAOGGMSYPG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=C(N2)C=C(C=C3)F |
Computed by PubChem (NCBI)