cas: 635713-68-7 — see every product listed under this CAS number, including other names
1'H-Spiro[piperidine-4,4'-quinazolin]-2'(3'H)-one 96% (CAS 635713-68-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A122637-100mg |
| cas | 635713-68-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 520.56 Pln | |
| Ambeed | 250mg | 921.06 Pln | |
| Ambeed | 1g | 2189.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A122637 |
Spiro[1,3-dihydroquinazoline-4,4'-piperidine]-2-one (CAS 635713-68-7) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. IUPAC name: spiro[1,3-dihydroquinazoline-4,4'-piperidine]-2-one. InChIKey: CFLDCJYCZAHJCK-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | spiro[1,3-dihydroquinazoline-4,4'-piperidine]-2-one |
| InChIKey | CFLDCJYCZAHJCK-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=CC=CC=C3NC(=O)N2 |
Computed by PubChem (NCBI)