CAS 506407-84-7 appears in our catalog under these names: 5-(4-(tert-Butyl)phenyl)-1,3,4-oxadiazol-2-amine, 95%, 5–(4–(tert–Butyl)phenyl)–1,3,4–oxadiazol–2–amine, 5-(4-(tert-Butyl)phenyl)-1,3,4-oxadiazol-2-amine, 97%, 97%, 5-(4-(tert-Butyl)phenyl)-1,3,4-oxadiazol-2-amine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 50mg.
5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-amine (CAS 506407-84-7) is a chemical compound with the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. IUPAC name: 5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-amine. InChIKey: OISTTWCWVFSFNE-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O |
|---|---|
| Molecular weight | 217.27 g/mol |
| IUPAC name | 5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | OISTTWCWVFSFNE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)