CAS 19053-14-6 appears in our catalog under these names: 4,4''-Diiodo-p-terphenyl, 95%, 4,4''-Diiodo-p-terphenyl, >98.0%(HPLC), 4,4''-Diiodo-1,1':4',1''-terphenyl, 1,1':4',1''-Terphenyl, 4,4''-diiodo-. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
1,4-bis(4-iodophenyl)benzene (CAS 19053-14-6) is a chemical compound with the molecular formula C18H12I2 and a molecular weight of 482.1 g/mol. IUPAC name: 1,4-bis(4-iodophenyl)benzene. InChIKey: QGMMWGLDOBFHTL-UHFFFAOYSA-N.
| Molecular formula | C18H12I2 |
|---|---|
| Molecular weight | 482.1 g/mol |
| IUPAC name | 1,4-bis(4-iodophenyl)benzene |
| InChIKey | QGMMWGLDOBFHTL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)I)C3=CC=C(C=C3)I |
Computed by PubChem (NCBI)