CAS 96843-21-9 is the registry number for 2',5'-Diiodo-p-terphenyl, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1,4-diiodo-2,5-diphenylbenzene (CAS 96843-21-9) is a chemical compound with the molecular formula C18H12I2 and a molecular weight of 482.1 g/mol. IUPAC name: 1,4-diiodo-2,5-diphenylbenzene. InChIKey: DBWNLYZBUNSDRL-UHFFFAOYSA-N.
| Molecular formula | C18H12I2 |
|---|---|
| Molecular weight | 482.1 g/mol |
| IUPAC name | 1,4-diiodo-2,5-diphenylbenzene |
| InChIKey | DBWNLYZBUNSDRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2I)C3=CC=CC=C3)I |
Computed by PubChem (NCBI)