cas: 474510-57-1 — see every product listed under this CAS number, including other names
1,1'-(Methylenebis(4,1-phenylene))bis(2-hydroxy-2-methylpropan-1-one) 98% (CAS 474510-57-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A505331-25g |
| cas | 474510-57-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 159.00 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1093.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A505331 |
2-hydroxy-1-[4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one (CAS 474510-57-1) is a chemical compound with the molecular formula C21H24O4 and a molecular weight of 340.4 g/mol. IUPAC name: 2-hydroxy-1-[4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one. InChIKey: PCKZAVNWRLEHIP-UHFFFAOYSA-N.
| Molecular formula | C21H24O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2-hydroxy-1-[4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one |
| InChIKey | PCKZAVNWRLEHIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)C1=CC=C(C=C1)CC2=CC=C(C=C2)C(=O)C(C)(C)O)O |
Computed by PubChem (NCBI)