cas: 474510-57-1 — see every product listed under this CAS number, including other names
1,1'-(Methylenebis(4,1-phenylene))bis(2-hydroxy-2-methylpropan-1-one), 98%, 98% (CAS 474510-57-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E7M8-5g |
| cas | 474510-57-1 |
| size | 5g |
| availability | 4000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 256.40 Pln | |
| Chemat | 500g | 772.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-1-[4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one (CAS 474510-57-1) is a chemical compound with the molecular formula C21H24O4 and a molecular weight of 340.4 g/mol. IUPAC name: 2-hydroxy-1-[4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one. InChIKey: PCKZAVNWRLEHIP-UHFFFAOYSA-N.
| Molecular formula | C21H24O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2-hydroxy-1-[4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one |
| InChIKey | PCKZAVNWRLEHIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)C1=CC=C(C=C1)CC2=CC=C(C=C2)C(=O)C(C)(C)O)O |
Computed by PubChem (NCBI)