cas: 1190430-21-7 — see every product listed under this CAS number, including other names
1,1,1,2,2,3,3,4,4-Nonafluorononane (CAS 1190430-21-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F638039-1G |
| cas | 1190430-21-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 1794.18 Pln |
| delivery time | 3-4 weeks |
|---|
1,1,1,2,2,3,3,4,4-nonafluorononane (CAS 1190430-21-7) is a chemical compound with the molecular formula C9H11F9 and a molecular weight of 290.17 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4-nonafluorononane. InChIKey: GYDMBTYTWYNRGO-UHFFFAOYSA-N.
| Molecular formula | C9H11F9 |
|---|---|
| Molecular weight | 290.17 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4-nonafluorononane |
| InChIKey | GYDMBTYTWYNRGO-UHFFFAOYSA-N |
| SMILES | CCCCCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)