cas: 132182-92-4 — see every product listed under this CAS number, including other names
1,1,1,2,2,3,4,5,5,5-Decafluoro-3-Methoxy-4-(Trifluoromethyl)Pentane, 98%, 98% (CAS 132182-92-4) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1121CE-50g |
| cas | 132182-92-4 |
| size | 50g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 232.40 Pln | |
| Chemat | 250g | 650.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 25g | 160.40 Pln | |
| Chemat | 100g | 357.20 Pln | |
| Chemat | 500g | 1012.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)pentane (CAS 132182-92-4) is a chemical compound with the molecular formula C7H3F13O and a molecular weight of 350.08 g/mol. IUPAC name: 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)pentane. InChIKey: QKAGYSDHEJITFV-UHFFFAOYSA-N.
| Molecular formula | C7H3F13O |
|---|---|
| Molecular weight | 350.08 g/mol |
| IUPAC name | 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)pentane |
| InChIKey | QKAGYSDHEJITFV-UHFFFAOYSA-N |
| SMILES | COC(C(C(F)(F)F)(C(F)(F)F)F)(C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)