CAS 375-82-6 appears in our catalog under these names: 1H,1H-Perfluoro-1-heptanol, 95%, 1H,1H–Tridecafluoro–1–heptanol, 1H,1H-Tridecafluoro-1-heptanol, >95.0%(GC), 1H,1H-Perfluoroheptan-1-ol 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 1g, 100g, 5g, 25g.
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol (CAS 375-82-6) is a chemical compound with the molecular formula C7H3F13O and a molecular weight of 350.08 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol. InChIKey: STLNAVFVCIRZLL-UHFFFAOYSA-N.
| Molecular formula | C7H3F13O |
|---|---|
| Molecular weight | 350.08 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol |
| InChIKey | STLNAVFVCIRZLL-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)