CAS 2652-41-7 appears in our catalog under these names: 1,1,1-Triethyl-3,3,3-trimethyldisiloxane, 95%, 95%, 1,1,1-Triethyl-3,3,3-trimethyldisiloxane, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 100g.
Triethyl(trimethylsilyloxy)silane (CAS 2652-41-7) is a chemical compound with the molecular formula C9H24OSi2 and a molecular weight of 204.46 g/mol. IUPAC name: triethyl(trimethylsilyloxy)silane. InChIKey: LQCJNLRBPWMYFX-UHFFFAOYSA-N.
| Molecular formula | C9H24OSi2 |
|---|---|
| Molecular weight | 204.46 g/mol |
| IUPAC name | triethyl(trimethylsilyloxy)silane |
| InChIKey | LQCJNLRBPWMYFX-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)O[Si](C)(C)C |
Computed by PubChem (NCBI)