Products 2652-41-7

CAS 2652-41-7 is the registry number for 1,1,1-Triethyl-3,3,3-trimethyldisiloxane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Triethyl(trimethylsilyloxy)silane (CAS 2652-41-7) is a chemical compound with the molecular formula C9H24OSi2 and a molecular weight of 204.46 g/mol. IUPAC name: triethyl(trimethylsilyloxy)silane. InChIKey: LQCJNLRBPWMYFX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H24OSi2
Molecular weight204.46 g/mol
IUPAC nametriethyl(trimethylsilyloxy)silane
InChIKeyLQCJNLRBPWMYFX-UHFFFAOYSA-N
SMILESCC[Si](CC)(CC)O[Si](C)(C)C

Computed by PubChem (NCBI)