cas: 22306-30-5 — see every product listed under this CAS number, including other names
1,1,4,4,5,5,8,8-Octamethyl-1,2,3,4,5,6,7,8-octahydroanthracene 97% (CAS 22306-30-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A310975-250mg |
| cas | 22306-30-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 748.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A310975 |
1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracene (CAS 22306-30-5) is a chemical compound with the molecular formula C22H34 and a molecular weight of 298.5 g/mol. IUPAC name: 1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracene. InChIKey: NABKENULMAEYJW-UHFFFAOYSA-N.
| Molecular formula | C22H34 |
|---|---|
| Molecular weight | 298.5 g/mol |
| IUPAC name | 1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracene |
| InChIKey | NABKENULMAEYJW-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=CC3=C(C=C21)C(CCC3(C)C)(C)C)(C)C)C |
Computed by PubChem (NCBI)