CAS 22306-30-5 appears in our catalog under these names: 1,1,4,4,5,5,8,8-Octamethyl-2,3,6,7-tetrahydroanthracene, 98%, 1,1,4,4,5,5,8,8–Octamethyl–2,3,6,7–tetrahydroanthracene, 1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracene, 97%, 97%, 1,1,4,4,5,5,8,8-Octamethyl-1,2,3,4,5,6,7,8-octahydroanthracene, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 100g, 5g, 1g, 250mg, 10g.
1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracene (CAS 22306-30-5) is a chemical compound with the molecular formula C22H34 and a molecular weight of 298.5 g/mol. IUPAC name: 1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracene. InChIKey: NABKENULMAEYJW-UHFFFAOYSA-N.
| Molecular formula | C22H34 |
|---|---|
| Molecular weight | 298.5 g/mol |
| IUPAC name | 1,1,4,4,5,5,8,8-octamethyl-2,3,6,7-tetrahydroanthracene |
| InChIKey | NABKENULMAEYJW-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=CC3=C(C=C21)C(CCC3(C)C)(C)C)(C)C)C |
Computed by PubChem (NCBI)