cas: 1530-04-7 — see every product listed under this CAS number, including other names
1,1′-Hexylidenebis[benzene], 95%, 95% (CAS 1530-04-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D03-100mg |
| cas | 1530-04-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-phenylhexylbenzene (CAS 1530-04-7) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 1-phenylhexylbenzene. InChIKey: BXINIXQKBCSKKR-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 1-phenylhexylbenzene |
| InChIKey | BXINIXQKBCSKKR-UHFFFAOYSA-N |
| SMILES | CCCCCC(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)