CAS 4482-03-5 appears in our catalog under these names: 2,2',4,4',6,6'-Hexamethyl-1,1'-biphenyl, 95%, 2,2',4,4',6,6'–hexamethyl–1,1'–biphenyl, 2,2',4,4',6,6'-Hexamethyl-1,1'-biphenyl 95%, 2,2',4,4',6,6'-Hexamethyl-1,1'-biphenyl, 95%, 95%, 2,2',4,4',6,6'-HEXAMETHYL-1,1'-BIPHENYL, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)benzene (CAS 4482-03-5) is a chemical compound with the molecular formula C18H22 and a molecular weight of 238.4 g/mol. IUPAC name: 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)benzene. InChIKey: CWPWAQJHDDRCKP-UHFFFAOYSA-N.
| Molecular formula | C18H22 |
|---|---|
| Molecular weight | 238.4 g/mol |
| IUPAC name | 1,3,5-trimethyl-2-(2,4,6-trimethylphenyl)benzene |
| InChIKey | CWPWAQJHDDRCKP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=C(C=C(C=C2C)C)C)C |
Computed by PubChem (NCBI)