cas: 2016-04-8 — see every product listed under this CAS number, including other names
1,1-Bis(benzyloxy)-N,N-dimethylmethanamine 95% (CAS 2016-04-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A458983-1g |
| cas | 2016-04-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 25g | 1460.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A458983 |
N,N-dimethyl-1,1-bis(phenylmethoxy)methanamine (CAS 2016-04-8) is a chemical compound with the molecular formula C17H21NO2 and a molecular weight of 271.35 g/mol. IUPAC name: N,N-dimethyl-1,1-bis(phenylmethoxy)methanamine. InChIKey: JFIKHFNGAURIIB-UHFFFAOYSA-N.
| Molecular formula | C17H21NO2 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | N,N-dimethyl-1,1-bis(phenylmethoxy)methanamine |
| InChIKey | JFIKHFNGAURIIB-UHFFFAOYSA-N |
| SMILES | CN(C)C(OCC1=CC=CC=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)