CAS 308273-67-8 is the registry number for (-)-(S)-N-(3,4-Dimethoxybenzyl)-(1-phenylethyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1S)-N-[(3,4-dimethoxyphenyl)methyl]-1-phenylethanamine (CAS 308273-67-8) is a chemical compound with the molecular formula C17H21NO2 and a molecular weight of 271.35 g/mol. IUPAC name: (1S)-N-[(3,4-dimethoxyphenyl)methyl]-1-phenylethanamine. InChIKey: UPMJXBLRDCBHGF-ZDUSSCGKSA-N.
| Molecular formula | C17H21NO2 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | (1S)-N-[(3,4-dimethoxyphenyl)methyl]-1-phenylethanamine |
| InChIKey | UPMJXBLRDCBHGF-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NCC2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)