cas: 36805-97-7 — see every product listed under this CAS number, including other names
1,1-Di-tert-butoxy-N,N-dimethylmethanamine 90% (CAS 36805-97-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A482910-250mg |
| cas | 36805-97-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 264.69 Pln | |
| Ambeed | 25g | 770.88 Pln | |
| Ambeed | 100g | 2317.25 Pln | |
| Ambeed | 500g | 9059.00 Pln |
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A482910 |
N,N-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine (CAS 36805-97-7) is a chemical compound with the molecular formula C11H25NO2 and a molecular weight of 203.32 g/mol. IUPAC name: N,N-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine. InChIKey: DBNQIOANXZVWIP-UHFFFAOYSA-N.
| Molecular formula | C11H25NO2 |
|---|---|
| Molecular weight | 203.32 g/mol |
| IUPAC name | N,N-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine |
| InChIKey | DBNQIOANXZVWIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(N(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)