cas: 5802-60-8 — see every product listed under this CAS number, including other names
1,1-Dibenzylhydrazine, 96%,RG, 96%,RG (CAS 5802-60-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D95-1g |
| cas | 5802-60-8 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 314.00 Pln | |
| Chemat | 25g | 842.00 Pln |
| purity | 96%,RG |
|---|---|
| delivery time | 3 weeks |
1,1-dibenzylhydrazine (CAS 5802-60-8) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 1,1-dibenzylhydrazine. InChIKey: CZVXEAWVGZTLON-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 1,1-dibenzylhydrazine |
| InChIKey | CZVXEAWVGZTLON-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)