CAS 1501975-72-9 appears in our catalog under these names: N-[(2R)-2-Amino-2-phenylethyl]aniline, 96%, (R)-N2,1-Diphenylethane-1,2-diamine, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(1R)-N',1-diphenylethane-1,2-diamine (CAS 1501975-72-9) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: (1R)-N',1-diphenylethane-1,2-diamine. InChIKey: ZORMNFOQTHQKTD-AWEZNQCLSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | (1R)-N',1-diphenylethane-1,2-diamine |
| InChIKey | ZORMNFOQTHQKTD-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](CNC2=CC=CC=C2)N |
Computed by PubChem (NCBI)