cas: 874290-94-5 — see every product listed under this CAS number, including other names
1,1-Diethyl-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea 98% (CAS 874290-94-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A353677-250mg |
| cas | 874290-94-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A353677 |
1,1-diethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 874290-94-5) is a chemical compound with the molecular formula C17H27BN2O3 and a molecular weight of 318.2 g/mol. IUPAC name: 1,1-diethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: OEIVWKLPBDQFDR-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O3 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | 1,1-diethyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | OEIVWKLPBDQFDR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)N(CC)CC |
Computed by PubChem (NCBI)