Products 840521-76-8
CAS 840521-76-8 is the registry number for 3-(2-(Dimethylamino)ethylcarbamoyl)phenylboronic acid, pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[2-(dimethylamino)ethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 840521-76-8) is a chemical compound with the molecular formula C17H27BN2O3 and a molecular weight of 318.2 g/mol. IUPAC name: N-[2-(dimethylamino)ethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: KQUHTIHQDGBEMM-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O3 |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | N-[2-(dimethylamino)ethyl]-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | KQUHTIHQDGBEMM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NCCN(C)C |
Computed by PubChem (NCBI)