cas: 1443467-88-6 — see every product listed under this CAS number, including other names
1,1-Dimethylethyl 13-phenyl-3,6,9,12-tetraoxatridecanoate, 97%, 97% (CAS 1443467-88-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HX3D-100mg |
| cas | 1443467-88-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 846.80 Pln | |
| Chemat | 5g | 2805.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]acetate (CAS 1443467-88-6) is a chemical compound with the molecular formula C19H30O6 and a molecular weight of 354.4 g/mol. IUPAC name: tert-butyl 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]acetate. InChIKey: CPMNHAPGRNEYDX-UHFFFAOYSA-N.
| Molecular formula | C19H30O6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]acetate |
| InChIKey | CPMNHAPGRNEYDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCC1=CC=CC=C1 |
Computed by PubChem (NCBI)