cas: 1443467-88-6 — see every product listed under this CAS number, including other names
Benzyl-PEG3-CH2-Boc 97% (CAS 1443467-88-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754602-100mg |
| cas | 1443467-88-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 3763.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A754602 |
Tert-butyl 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]acetate (CAS 1443467-88-6) is a chemical compound with the molecular formula C19H30O6 and a molecular weight of 354.4 g/mol. IUPAC name: tert-butyl 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]acetate. InChIKey: CPMNHAPGRNEYDX-UHFFFAOYSA-N.
| Molecular formula | C19H30O6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | tert-butyl 2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]acetate |
| InChIKey | CPMNHAPGRNEYDX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCOCCOCC1=CC=CC=C1 |
Computed by PubChem (NCBI)