cas: 518044-37-6 — see every product listed under this CAS number, including other names
1,1-Dimethylethyl 21-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-4,7,10,13,16,19-hexaoxaheneicosanoate, 95%, 95% (CAS 518044-37-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 50mg, 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I00I-250mg |
| cas | 518044-37-6 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1110.80 Pln | |
| Chemat | 50mg | 429.20 Pln | |
| Chemat | 100mg | 678.80 Pln | |
| Chemat | 1g | 3026.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 518044-37-6) is a chemical compound with the molecular formula C23H39NO10 and a molecular weight of 489.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: CUCNCZLNASXRTC-UHFFFAOYSA-N.
| Molecular formula | C23H39NO10 |
|---|---|
| Molecular weight | 489.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | CUCNCZLNASXRTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)