cas: 518044-37-6 — see every product listed under this CAS number, including other names
Mal-PEG6-Boc, 95% (CAS 518044-37-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554685-100MG |
| cas | 518044-37-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 825.77 Pln | |
| Fluorochem | 250mg | 1408.90 Pln | |
| Fluorochem | 1g | 3954.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 518044-37-6) is a chemical compound with the molecular formula C23H39NO10 and a molecular weight of 489.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: CUCNCZLNASXRTC-UHFFFAOYSA-N.
| Molecular formula | C23H39NO10 |
|---|---|
| Molecular weight | 489.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | CUCNCZLNASXRTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)