cas: 2055014-96-3 — see every product listed under this CAS number, including other names
1,1-Dimethylethyl 4,7,10,13,16,19,22,25-octaoxaoctacos-27-ynoate, 97%, 97% (CAS 2055014-96-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120E2Y-50mg |
| cas | 2055014-96-3 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 150.80 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1902.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2055014-96-3) is a chemical compound with the molecular formula C24H44O10 and a molecular weight of 492.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: IGEMRRCREJIMCQ-UHFFFAOYSA-N.
| Molecular formula | C24H44O10 |
|---|---|
| Molecular weight | 492.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | IGEMRRCREJIMCQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCC#C |
Computed by PubChem (NCBI)