cas: 2055014-96-3 — see every product listed under this CAS number, including other names
Propargyl-PEG8-Boc, 97% (CAS 2055014-96-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554641-100MG |
| cas | 2055014-96-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 570.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2055014-96-3) is a chemical compound with the molecular formula C24H44O10 and a molecular weight of 492.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: IGEMRRCREJIMCQ-UHFFFAOYSA-N.
| Molecular formula | C24H44O10 |
|---|---|
| Molecular weight | 492.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | IGEMRRCREJIMCQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCC#C |
Computed by PubChem (NCBI)