cas: 1194374-77-0 — see every product listed under this CAS number, including other names
1,1-Dimethylethyl 6-methyl-2,7-diazaspiro[3.5]nonane-2-carboxylate, 97%, 97% (CAS 1194374-77-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ILA0-100mg |
| cas | 1194374-77-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1322.00 Pln | |
| Chemat | 250mg | 2085.20 Pln | |
| Chemat | 500mg | 3434.00 Pln | |
| Chemat | 1g | 5109.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-methyl-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS 1194374-77-0) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl 6-methyl-2,7-diazaspiro[3.5]nonane-2-carboxylate. InChIKey: YGDKCDSMRAWJHY-UHFFFAOYSA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl 6-methyl-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| InChIKey | YGDKCDSMRAWJHY-UHFFFAOYSA-N |
| SMILES | CC1CC2(CCN1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)