Products 1263281-19-1
CAS 1263281-19-1 is the registry number for tert-butyl (6S)-6-methyl-2,7-diazaspiro[3.5]nonane-2-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (6S)-6-methyl-2,7-diazaspiro[3.5]nonane-2-carboxylate (CAS 1263281-19-1) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl (6S)-6-methyl-2,7-diazaspiro[3.5]nonane-2-carboxylate. InChIKey: YGDKCDSMRAWJHY-JTQLQIEISA-N.
| Molecular formula | C13H24N2O2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | tert-butyl (6S)-6-methyl-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| InChIKey | YGDKCDSMRAWJHY-JTQLQIEISA-N |
| SMILES | C[C@H]1CC2(CCN1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)