cas: 6571-51-3 — see every product listed under this CAS number, including other names
1,11-Dioxa[11]paracyclophane, >97.0%(GC) (CAS 6571-51-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D4298-250MG |
| cas | 6571-51-3 |
| size | 250mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 250mg | 349.46 Pln | |
| TCI | 1g | 1096.88 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
2,12-dioxabicyclo[11.2.2]heptadeca-1(15),13,16-triene (CAS 6571-51-3) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: 2,12-dioxabicyclo[11.2.2]heptadeca-1(15),13,16-triene. InChIKey: LTROLYACVISZRU-UHFFFAOYSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | 2,12-dioxabicyclo[11.2.2]heptadeca-1(15),13,16-triene |
| InChIKey | LTROLYACVISZRU-UHFFFAOYSA-N |
| SMILES | C1CCCCOC2=CC=C(C=C2)OCCCC1 |
Computed by PubChem (NCBI)