Products 5444-75-7
CAS 5444-75-7 appears in our catalog under these names: Benzoic acid 2-ethylhexyl ester, 98%, 2-Ethylhexyl benzoate, 95%, 2–Ethylhexyl Benzoate, 2-Ethylhexyl Benzoate, >99.0%(GC), 2-Ethylhexyl benzoate 95%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 100ml, 25ml, 5ml, 250mg.
2-ethylhexyl benzoate (CAS 5444-75-7) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: 2-ethylhexyl benzoate. InChIKey: UADWUILHKRXHMM-UHFFFAOYSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | 2-ethylhexyl benzoate |
| InChIKey | UADWUILHKRXHMM-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)