cas: 62133-77-1 — see every product listed under this CAS number, including other names
1,2,3,4-Tetra-O-acetyl-β-D-glucuronic acid 98% (CAS 62133-77-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1247657-10g |
| cas | 62133-77-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 6377.88 Pln | |
| Ambeed | 100mg | 503.88 Pln | |
| Ambeed | 250mg | 642.94 Pln | |
| Ambeed | 1g | 1121.31 Pln | |
| Ambeed | 5g | 4008.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1247657 |
(2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylic acid (CAS 62133-77-1) is a chemical compound with the molecular formula C14H18O11 and a molecular weight of 362.29 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylic acid. InChIKey: FHWVABAZBHDMEY-ZXPJVPCYSA-N.
| Molecular formula | C14H18O11 |
|---|---|
| Molecular weight | 362.29 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylic acid |
| InChIKey | FHWVABAZBHDMEY-ZXPJVPCYSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC(=O)C)C(=O)O)OC(=O)C |
Computed by PubChem (NCBI)