cas: 62133-77-1 — see every product listed under this CAS number, including other names
1,2,3,4-Tetra-O-acetyl-beta-D-glucuronic acid, 98.00% (CAS 62133-77-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 2g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM11760C-10g |
| cas | 62133-77-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 8351.85 Pln | |
| Chemat | 1g | 1974.08 Pln | |
| Chemat | 2g | 2765.25 Pln | |
| Chemat | 5g | 5088.31 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
(2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylic acid (CAS 62133-77-1) is a chemical compound with the molecular formula C14H18O11 and a molecular weight of 362.29 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylic acid. InChIKey: FHWVABAZBHDMEY-ZXPJVPCYSA-N.
| Molecular formula | C14H18O11 |
|---|---|
| Molecular weight | 362.29 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylic acid |
| InChIKey | FHWVABAZBHDMEY-ZXPJVPCYSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC(=O)C)C(=O)O)OC(=O)C |
Computed by PubChem (NCBI)