CAS 3082-96-0 appears in our catalog under these names: 1,2,3,4-Tetra-O-acetyl-D-glucuronide methyl ester, 95%, 1,2,3,4-Tetra-O-acetyl-Alpha,Beta-D-glucuronic Acid, Methyl Ester (mixture of anomers), (3R,4S,5S,6S)–6–(Methoxycarbonyl)tetrahydro–2H–pyran–2,3,4,5–tetrayl tetraacetate, 1,2,3,4-Tetra-O-acetyl-D-glucuronide methyl ester, Methyl D-glucopyranuronate 1,2,3,4-tetraacetate, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 2,5g, 50g, 500g.
Methyl (2S,3S,4S,5R)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate (CAS 3082-96-0) is a chemical compound with the molecular formula C15H20O11 and a molecular weight of 376.31 g/mol. IUPAC name: methyl (2S,3S,4S,5R)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate. InChIKey: DPOQCELSZBSZGX-BVIXPPBVSA-N.
| Molecular formula | C15H20O11 |
|---|---|
| Molecular weight | 376.31 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate |
| InChIKey | DPOQCELSZBSZGX-BVIXPPBVSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](OC([C@@H]1OC(=O)C)OC(=O)C)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)