CAS 40269-24-7 is the registry number for 1,2,3,4-Tetra-O-acetyl-a-D-galacturonic acid methyl ester. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g.
Methyl (2S,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate (CAS 40269-24-7) is a chemical compound with the molecular formula C15H20O11 and a molecular weight of 376.31 g/mol. IUPAC name: methyl (2S,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate. InChIKey: DPOQCELSZBSZGX-JZQBXTLISA-N.
| Molecular formula | C15H20O11 |
|---|---|
| Molecular weight | 376.31 g/mol |
| IUPAC name | methyl (2S,3R,4S,5R)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate |
| InChIKey | DPOQCELSZBSZGX-JZQBXTLISA-N |
| SMILES | CC(=O)O[C@H]1[C@H]([C@H](OC([C@@H]1OC(=O)C)OC(=O)C)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)