cas: 65086-12-6 — see every product listed under this CAS number, including other names
1,2,3-Trimethyl-1H-imidazol-3-ium methyl sulfate, 98%, 98% (CAS 65086-12-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EB7I-5g |
| cas | 65086-12-6 |
| size | 5g |
| availability | 800g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 256.40 Pln | |
| Chemat | 25g | 645.20 Pln | |
| Chemat | 100g | 1763.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl sulfate;1,2,3-trimethylimidazol-1-ium (CAS 65086-12-6) is a chemical compound with the molecular formula C7H14N2O4S and a molecular weight of 222.26 g/mol. IUPAC name: methyl sulfate;1,2,3-trimethylimidazol-1-ium. InChIKey: OUAUEIYYLHUEPK-UHFFFAOYSA-M.
| Molecular formula | C7H14N2O4S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | methyl sulfate;1,2,3-trimethylimidazol-1-ium |
| InChIKey | OUAUEIYYLHUEPK-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C=CN1C)C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)