cas: 65086-12-6 — see every product listed under this CAS number, including other names
1,2,3-Trimethyl-1H-imidazol-3-ium methyl sulfate, 98% (CAS 65086-12-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F754536-5G |
| cas | 65086-12-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 445.69 Pln | |
| Fluorochem | 25g | 1174.60 Pln | |
| Fluorochem | 100g | 3298.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl sulfate;1,2,3-trimethylimidazol-1-ium (CAS 65086-12-6) is a chemical compound with the molecular formula C7H14N2O4S and a molecular weight of 222.26 g/mol. IUPAC name: methyl sulfate;1,2,3-trimethylimidazol-1-ium. InChIKey: OUAUEIYYLHUEPK-UHFFFAOYSA-M.
| Molecular formula | C7H14N2O4S |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | methyl sulfate;1,2,3-trimethylimidazol-1-ium |
| InChIKey | OUAUEIYYLHUEPK-UHFFFAOYSA-M |
| SMILES | CC1=[N+](C=CN1C)C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)