1,2,4,5-Tetrabromo-3,6-difluorobenzene, 97%
cas: 5172-13-4 — see every product listed under this CAS number, including other names
1,2,4,5-Tetrabromo-3,6-difluorobenzene, 97% (CAS 5172-13-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12XC1P-100mg |
| cas | 5172-13-4 |
| size | 100mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 664.40 Pln | |
| Chemat | 5g | 2853.20 Pln | |
| Chemat | 10g | 4528.40 Pln | |
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 919.49 Pln | |
| Fluorochem | 5g | 3022.91 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1,2,4,5-tetrabromo-3,6-difluorobenzene (CAS 5172-13-4) is a chemical compound with the molecular formula C6Br4F2 and a molecular weight of 429.68 g/mol. IUPAC name: 1,2,4,5-tetrabromo-3,6-difluorobenzene. InChIKey: ZRZJBNHRCBJBGN-UHFFFAOYSA-N.
| Molecular formula | C6Br4F2 |
|---|---|
| Molecular weight | 429.68 g/mol |
| IUPAC name | 1,2,4,5-tetrabromo-3,6-difluorobenzene |
| InChIKey | ZRZJBNHRCBJBGN-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1Br)Br)F)Br)Br)F |
Computed by PubChem (NCBI)