cas: 447463-65-2 — see every product listed under this CAS number, including other names
1,2,4,5-Tetrakis(tert-butylthio)benzene 97% (CAS 447463-65-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A152941-250mg |
| cas | 447463-65-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 10g | 1093.50 Pln | |
| Ambeed | 25g | 2612.06 Pln | |
| Ambeed | 100g | 10127.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A152941 |
1,2,4,5-tetrakis(tert-butylsulfanyl)benzene (CAS 447463-65-2) is a chemical compound with the molecular formula C22H38S4 and a molecular weight of 430.8 g/mol. IUPAC name: 1,2,4,5-tetrakis(tert-butylsulfanyl)benzene. InChIKey: LOCUYYPERSWXJI-UHFFFAOYSA-N.
| Molecular formula | C22H38S4 |
|---|---|
| Molecular weight | 430.8 g/mol |
| IUPAC name | 1,2,4,5-tetrakis(tert-butylsulfanyl)benzene |
| InChIKey | LOCUYYPERSWXJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)SC1=CC(=C(C=C1SC(C)(C)C)SC(C)(C)C)SC(C)(C)C |
Computed by PubChem (NCBI)