1,2-BIS(2-CHLOROPHENYL)DISULFANE, 98%
cas: 31121-19-4 — see every product listed under this CAS number, including other names
1,2-BIS(2-CHLOROPHENYL)DISULFANE, 98% (CAS 31121-19-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g, 25g, 100g, 100mg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F824558-250MG |
| cas | 31121-19-4 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 2.5g | 1226.67 Pln | |
| Fluorochem | 5g | 1476.58 Pln | |
| Fluorochem | 10g | 2075.33 Pln | |
| Fluorochem | 25g | 3892.40 Pln | |
| Fluorochem | 100g | 5235.67 Pln | |
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 320.31 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1494.00 Pln | |
| Ambeed | 10g | 2050.25 Pln | |
| Ambeed | 25g | 3908.12 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-chloro-2-[(2-chlorophenyl)disulfanyl]benzene (CAS 31121-19-4) is a chemical compound with the molecular formula C12H8Cl2S2 and a molecular weight of 287.2 g/mol. IUPAC name: 1-chloro-2-[(2-chlorophenyl)disulfanyl]benzene. InChIKey: IQCDDWQDDMUOCQ-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2S2 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 1-chloro-2-[(2-chlorophenyl)disulfanyl]benzene |
| InChIKey | IQCDDWQDDMUOCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)SSC2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)