CAS 31121-19-4 appears in our catalog under these names: 2,2'-Dichloro diphenyl disulfide, 98%, 2,2'-Dichloro Diphenyl Disulfide, >95% (HPLC), 2,2'-Dichloro diphenyl disulfide, 1,2-Bis(2-chlorophenyl)disulfane 98%, 1,2-BIS(2-CHLOROPHENYL)DISULFANE, 98%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 2g, 100mg, 25g, 2.5g.
1-chloro-2-[(2-chlorophenyl)disulfanyl]benzene (CAS 31121-19-4) is a chemical compound with the molecular formula C12H8Cl2S2 and a molecular weight of 287.2 g/mol. IUPAC name: 1-chloro-2-[(2-chlorophenyl)disulfanyl]benzene. InChIKey: IQCDDWQDDMUOCQ-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2S2 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 1-chloro-2-[(2-chlorophenyl)disulfanyl]benzene |
| InChIKey | IQCDDWQDDMUOCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)SSC2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)